C22H31N3O4S2 — CID 21005993
N'-[(3S,4R)-4-(benzenesulfonyl)-1,1-dioxothiolan-3-yl]-1-[4-(dimethylamino)phenyl]-N,N-dimethylethane-1,2-diamine (PubChem CID 21005993) has the molecular formula C22H31N3O4S2 and a molecular weight of 465.64 g/mol. Its IUPAC name is N'-[(3S,4R)-4-(benzenesulfonyl)-1,1-dioxothiolan-3-yl]-1-[4-(dimethylamino)phenyl]-N,N-dimethylethane-1,2-diamine.
| Compound Name | N'-[(3S,4R)-4-(benzenesulfonyl)-1,1-dioxothiolan-3-yl]-1-[4-(dimethylamino)phenyl]-N,N-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 21005993 |
| Molecular Formula | C22H31N3O4S2 |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | N'-[(3S,4R)-4-(benzenesulfonyl)-1,1-dioxothiolan-3-yl]-1-[4-(dimethylamino)phenyl]-N,N-dimethylethane-1,2-diamine |
| SMILES | CN(C)c1ccc(C(CN[C@H]2CS(=O)(=O)C[C@@H]2S(=O)(=O)c2ccccc2)N(C)C)cc1 |
| InChI | InChI=1S/C22H31N3O4S2/c1-24(2)18-12-10-17(11-13-18)21(25(3)4)14-23-20-15-30(26,27)16-22(20)31(28,29)19-8-6-5-7-9-19/h5-13,20-23H,14-16H2,1-4H3/t20-,21?,22-/m0/s1 |
| InChIKey | ARFJWHIMNZHCPB-NHNZYLEHSA-N |
| XLogP | 1.58 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|