C23H31FN2O5S2 — CID 21006586
1-(4-fluorophenyl)-N'-[(3S,4R)-4-(2-methoxy-4,5-dimethylphenyl)sulfonyl-1,1-dioxothiolan-3-yl]-N,N-dimethylethane-1,2-diamine (PubChem CID 21006586) has the molecular formula C23H31FN2O5S2 and a molecular weight of 498.64 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N'-[(3S,4R)-4-(2-methoxy-4,5-dimethylphenyl)sulfonyl-1,1-dioxothiolan-3-yl]-N,N-dimethylethane-1,2-diamine.
| Compound Name | 1-(4-fluorophenyl)-N'-[(3S,4R)-4-(2-methoxy-4,5-dimethylphenyl)sulfonyl-1,1-dioxothiolan-3-yl]-N,N-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 21006586 |
| Molecular Formula | C23H31FN2O5S2 |
| Molecular Weight | 498.64 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | 1-(4-fluorophenyl)-N'-[(3S,4R)-4-(2-methoxy-4,5-dimethylphenyl)sulfonyl-1,1-dioxothiolan-3-yl]-N,N-dimethylethane-1,2-diamine |
| SMILES | COc1cc(C)c(C)cc1S(=O)(=O)[C@H]1CS(=O)(=O)C[C@@H]1NCC(c1ccc(F)cc1)N(C)C |
| InChI | InChI=1S/C23H31FN2O5S2/c1-15-10-21(31-5)22(11-16(15)2)33(29,30)23-14-32(27,28)13-19(23)25-12-20(26(3)4)17-6-8-18(24)9-7-17/h6-11,19-20,23,25H,12-14H2,1-5H3/t19-,20?,23-/m0/s1 |
| InChIKey | HYAAMTNMXRPEBN-OKVILHKKSA-N |
| XLogP | 2.28 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.64 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |