C17H20ClNO6S3 — CID 21006677
(3S,4R)-4-(5-chlorothiophen-2-yl)sulfonyl-N-[2-(4-methoxyphenoxy)ethyl]-1,1-dioxothiolan-3-amine (PubChem CID 21006677) has the molecular formula C17H20ClNO6S3 and a molecular weight of 466.00 g/mol. Its IUPAC name is (3S,4R)-4-(5-chlorothiophen-2-yl)sulfonyl-N-[2-(4-methoxyphenoxy)ethyl]-1,1-dioxothiolan-3-amine.
| Compound Name | (3S,4R)-4-(5-chlorothiophen-2-yl)sulfonyl-N-[2-(4-methoxyphenoxy)ethyl]-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 21006677 |
| Molecular Formula | C17H20ClNO6S3 |
| Molecular Weight | 466.00 g/mol |
| Exact Mass | 465.01 |
| IUPAC Name | (3S,4R)-4-(5-chlorothiophen-2-yl)sulfonyl-N-[2-(4-methoxyphenoxy)ethyl]-1,1-dioxothiolan-3-amine |
| SMILES | COc1ccc(OCCN[C@H]2CS(=O)(=O)C[C@@H]2S(=O)(=O)c2ccc(Cl)s2)cc1 |
| InChI | InChI=1S/C17H20ClNO6S3/c1-24-12-2-4-13(5-3-12)25-9-8-19-14-10-27(20,21)11-15(14)28(22,23)17-7-6-16(18)26-17/h2-7,14-15,19H,8-11H2,1H3/t14-,15-/m0/s1 |
| InChIKey | NCYBXXOIGZCZBZ-GJZGRUSLSA-N |
| XLogP | 2.02 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.00 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|