C14H15ClN2O4S — CID 21007236
2-chloro-4-(4-methyl-1,1,3-trioxo-1,2-thiazolidin-2-yl)-N-prop-2-enylbenzamide (PubChem CID 21007236) has the molecular formula C14H15ClN2O4S and a molecular weight of 342.80 g/mol. Its IUPAC name is 2-chloro-4-(4-methyl-1,1,3-trioxo-1,2-thiazolidin-2-yl)-N-prop-2-enylbenzamide.
| Compound Name | 2-chloro-4-(4-methyl-1,1,3-trioxo-1,2-thiazolidin-2-yl)-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 21007236 |
| Molecular Formula | C14H15ClN2O4S |
| Molecular Weight | 342.80 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 2-chloro-4-(4-methyl-1,1,3-trioxo-1,2-thiazolidin-2-yl)-N-prop-2-enylbenzamide |
| SMILES | C=CCNC(=O)c1ccc(N2C(=O)C(C)CS2(=O)=O)cc1Cl |
| InChI | InChI=1S/C14H15ClN2O4S/c1-3-6-16-13(18)11-5-4-10(7-12(11)15)17-14(19)9(2)8-22(17,20)21/h3-5,7,9H,1,6,8H2,2H3,(H,16,18) |
| InChIKey | LFGOLHJPYIBQOF-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.80 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|