C16H13N3O5S — CID 2100728
(E)-3-[4-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)sulfamoyl]phenyl]prop-2-enoic acid (PubChem CID 2100728) has the molecular formula C16H13N3O5S and a molecular weight of 359.36 g/mol. Its IUPAC name is (E)-3-[4-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)sulfamoyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)sulfamoyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 2100728 |
| Molecular Formula | C16H13N3O5S |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | (E)-3-[4-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)sulfamoyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(S(=O)(=O)Nc2ccc3[nH]c(=O)[nH]c3c2)cc1 |
| InChI | InChI=1S/C16H13N3O5S/c20-15(21)8-3-10-1-5-12(6-2-10)25(23,24)19-11-4-7-13-14(9-11)18-16(22)17-13/h1-9,19H,(H,20,21)(H2,17,18,22)/b8-3+ |
| InChIKey | MNZDHNDHXQPWOO-FPYGCLRLSA-N |
| XLogP | 1.75 |
| TPSA | 132.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|