C17H24N2O4S — CID 21007460
3-(4,4-dimethyl-1,1,3-trioxo-1,2-thiazolidin-2-yl)-N-pentylbenzamide (PubChem CID 21007460) has the molecular formula C17H24N2O4S and a molecular weight of 352.46 g/mol. Its IUPAC name is 3-(4,4-dimethyl-1,1,3-trioxo-1,2-thiazolidin-2-yl)-N-pentylbenzamide.
| Compound Name | 3-(4,4-dimethyl-1,1,3-trioxo-1,2-thiazolidin-2-yl)-N-pentylbenzamide |
|---|---|
| PubChem CID | 21007460 |
| Molecular Formula | C17H24N2O4S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 3-(4,4-dimethyl-1,1,3-trioxo-1,2-thiazolidin-2-yl)-N-pentylbenzamide |
| SMILES | CCCCCNC(=O)c1cccc(N2C(=O)C(C)(C)CS2(=O)=O)c1 |
| InChI | InChI=1S/C17H24N2O4S/c1-4-5-6-10-18-15(20)13-8-7-9-14(11-13)19-16(21)17(2,3)12-24(19,22)23/h7-9,11H,4-6,10,12H2,1-3H3,(H,18,20) |
| InChIKey | RUUACGVRNARXBU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|