C17H11Cl2F4N3O3 — CID 2100785
7-(2,4-dichloro-5-fluorophenyl)-1-(2-methoxyethyl)-5-(trifluoromethyl)pyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 2100785) has the molecular formula C17H11Cl2F4N3O3 and a molecular weight of 452.19 g/mol. Its IUPAC name is 7-(2,4-dichloro-5-fluorophenyl)-1-(2-methoxyethyl)-5-(trifluoromethyl)pyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 7-(2,4-dichloro-5-fluorophenyl)-1-(2-methoxyethyl)-5-(trifluoromethyl)pyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 2100785 |
| Molecular Formula | C17H11Cl2F4N3O3 |
| Molecular Weight | 452.19 g/mol |
| Exact Mass | 451.01 |
| IUPAC Name | 7-(2,4-dichloro-5-fluorophenyl)-1-(2-methoxyethyl)-5-(trifluoromethyl)pyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | COCCn1c(=O)[nH]c(=O)c2c(C(F)(F)F)cc(-c3cc(F)c(Cl)cc3Cl)nc21 |
| InChI | InChI=1S/C17H11Cl2F4N3O3/c1-29-3-2-26-14-13(15(27)25-16(26)28)8(17(21,22)23)5-12(24-14)7-4-11(20)10(19)6-9(7)18/h4-6H,2-3H2,1H3,(H,25,27,28) |
| InChIKey | DGSXCKVEMYOLIP-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.19 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|