C18H24N4O7S — CID 21008110
N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2,4-dioxo-1H-pyrimidine-5-sulfonamide (PubChem CID 21008110) has the molecular formula C18H24N4O7S and a molecular weight of 440.48 g/mol. Its IUPAC name is N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2,4-dioxo-1H-pyrimidine-5-sulfonamide.
| Compound Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2,4-dioxo-1H-pyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 21008110 |
| Molecular Formula | C18H24N4O7S |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2,4-dioxo-1H-pyrimidine-5-sulfonamide |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NS(=O)(=O)c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H24N4O7S/c1-3-28-14-10-13(22-5-7-27-8-6-22)15(29-4-2)9-12(14)21-30(25,26)16-11-19-18(24)20-17(16)23/h9-11,21H,3-8H2,1-2H3,(H2,19,20,23,24) |
| InChIKey | KIHYEKGLPNHCNV-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 142.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|