C15H19N5O7S2 — CID 21008136
1-butyl-3-[4-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonylamino]phenyl]sulfonylurea (PubChem CID 21008136) has the molecular formula C15H19N5O7S2 and a molecular weight of 445.48 g/mol. Its IUPAC name is 1-butyl-3-[4-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonylamino]phenyl]sulfonylurea.
| Compound Name | 1-butyl-3-[4-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonylamino]phenyl]sulfonylurea |
|---|---|
| PubChem CID | 21008136 |
| Molecular Formula | C15H19N5O7S2 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | 1-butyl-3-[4-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonylamino]phenyl]sulfonylurea |
| SMILES | CCCCNC(=O)NS(=O)(=O)c1ccc(NS(=O)(=O)c2c[nH]c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C15H19N5O7S2/c1-2-3-8-16-15(23)20-28(24,25)11-6-4-10(5-7-11)19-29(26,27)12-9-17-14(22)18-13(12)21/h4-7,9,19H,2-3,8H2,1H3,(H2,16,20,23)(H2,17,18,21,22) |
| InChIKey | VFUAOKRMDSIWDM-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 187.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|