C10H13N3O4S — CID 21008159
2,4-dioxo-N,N-bis(prop-2-enyl)-1H-pyrimidine-5-sulfonamide (PubChem CID 21008159) has the molecular formula C10H13N3O4S and a molecular weight of 271.30 g/mol. Its IUPAC name is 2,4-dioxo-N,N-bis(prop-2-enyl)-1H-pyrimidine-5-sulfonamide.
| Compound Name | 2,4-dioxo-N,N-bis(prop-2-enyl)-1H-pyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 21008159 |
| Molecular Formula | C10H13N3O4S |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 2,4-dioxo-N,N-bis(prop-2-enyl)-1H-pyrimidine-5-sulfonamide |
| SMILES | C=CCN(CC=C)S(=O)(=O)c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H13N3O4S/c1-3-5-13(6-4-2)18(16,17)8-7-11-10(15)12-9(8)14/h3-4,7H,1-2,5-6H2,(H2,11,12,14,15) |
| InChIKey | RWTQLXOEGAJOBA-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 103.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|