C20H24N4O3S — CID 21008890
N-[2-(1H-benzimidazol-2-yl)ethyl]-4-(diethylsulfamoyl)benzamide (PubChem CID 21008890) has the molecular formula C20H24N4O3S and a molecular weight of 400.50 g/mol. Its IUPAC name is N-[2-(1H-benzimidazol-2-yl)ethyl]-4-(diethylsulfamoyl)benzamide.
| Compound Name | N-[2-(1H-benzimidazol-2-yl)ethyl]-4-(diethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 21008890 |
| Molecular Formula | C20H24N4O3S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | N-[2-(1H-benzimidazol-2-yl)ethyl]-4-(diethylsulfamoyl)benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)NCCc2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C20H24N4O3S/c1-3-24(4-2)28(26,27)16-11-9-15(10-12-16)20(25)21-14-13-19-22-17-7-5-6-8-18(17)23-19/h5-12H,3-4,13-14H2,1-2H3,(H,21,25)(H,22,23) |
| InChIKey | ZPCWPLDZLAAACB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |