C21H16FN3O3S — CID 21009055
2-fluoro-N-[4-(3-oxo-4-prop-2-enyl-1,4-benzoxazin-6-yl)-1,3-thiazol-2-yl]benzamide (PubChem CID 21009055) has the molecular formula C21H16FN3O3S and a molecular weight of 409.44 g/mol. Its IUPAC name is 2-fluoro-N-[4-(3-oxo-4-prop-2-enyl-1,4-benzoxazin-6-yl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 2-fluoro-N-[4-(3-oxo-4-prop-2-enyl-1,4-benzoxazin-6-yl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 21009055 |
| Molecular Formula | C21H16FN3O3S |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | 2-fluoro-N-[4-(3-oxo-4-prop-2-enyl-1,4-benzoxazin-6-yl)-1,3-thiazol-2-yl]benzamide |
| SMILES | C=CCN1C(=O)COc2ccc(-c3csc(NC(=O)c4ccccc4F)n3)cc21 |
| InChI | InChI=1S/C21H16FN3O3S/c1-2-9-25-17-10-13(7-8-18(17)28-11-19(25)26)16-12-29-21(23-16)24-20(27)14-5-3-4-6-15(14)22/h2-8,10,12H,1,9,11H2,(H,23,24,27) |
| InChIKey | RQYYANWWSRNXRD-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|