About 6-ethyl-N-(8-ethyl-9H-carbazol-2-yl)thieno[2,3-d]pyrimidin-4-amine
6-ethyl-N-(8-ethyl-9H-carbazol-2-yl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 21010584) has the molecular formula C22H20N4S
and a molecular weight of 372.50 g/mol. Its IUPAC name is 6-ethyl-N-(8-ethyl-9H-carbazol-2-yl)thieno[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-ethyl-N-(8-ethyl-9H-carbazol-2-yl)thieno[2,3-d]pyrimidin-4-amine |
| PubChem CID | 21010584 |
| Molecular Formula | C22H20N4S |
| Molecular Weight | 372.50 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 6-ethyl-N-(8-ethyl-9H-carbazol-2-yl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCc1cc2c(Nc3ccc4c(c3)[nH]c3c(CC)cccc34)ncnc2s1 |
| InChI | InChI=1S/C22H20N4S/c1-3-13-6-5-7-17-16-9-8-14(10-19(16)26-20(13)17)25-21-18-11-15(4-2)27-22(18)24-12-23-21/h5-12,26H,3-4H2,1-2H3,(H,23,24,25) |
| InChIKey | ZMEDEMFQBGHXRU-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.50 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-ethyl-N-(8-ethyl-9H-carbazol-2-yl)thieno[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-N-(8-ethyl-9H-carbazol-2-yl)thieno[2,3-d]pyrimidin-4-amine?
The IUPAC name of 6-ethyl-N-(8-ethyl-9H-carbazol-2-yl)thieno[2,3-d]pyrimidin-4-amine (CID 21010584) is 6-ethyl-N-(8-ethyl-9H-carbazol-2-yl)thieno[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for 6-ethyl-N-(8-ethyl-9H-carbazol-2-yl)thieno[2,3-d]pyrimidin-4-amine?
The canonical SMILES for 6-ethyl-N-(8-ethyl-9H-carbazol-2-yl)thieno[2,3-d]pyrimidin-4-amine is CCc1cc2c(Nc3ccc4c(c3)[nH]c3c(CC)cccc34)ncnc2s1.
What is the InChIKey of 6-ethyl-N-(8-ethyl-9H-carbazol-2-yl)thieno[2,3-d]pyrimidin-4-amine?
The InChIKey is ZMEDEMFQBGHXRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N4S/c1-3-13-6-5-7-17-16-9-8-14(10-19(16)26-20(13)17)25-21-18-11-15(4-2)27-22(18)24-12-23-21/h5-12,26H,3-4H2,1-2H3,(H,23,24,25).
What are the key properties of 6-ethyl-N-(8-ethyl-9H-carbazol-2-yl)thieno[2,3-d]pyrimidin-4-amine?
6-ethyl-N-(8-ethyl-9H-carbazol-2-yl)thieno[2,3-d]pyrimidin-4-amine has a molecular weight of 372.50 g/mol, XLogP of 6.19, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-N-(8-ethyl-9H-carbazol-2-yl)thieno[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 21010584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).