About N-[3-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenyl]acetamide
N-[3-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenyl]acetamide (PubChem CID 21011861) has the molecular formula C20H16N4OS
and a molecular weight of 360.44 g/mol. Its IUPAC name is N-[3-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenyl]acetamide.
Molecular Properties
| Compound Name | N-[3-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenyl]acetamide |
| PubChem CID | 21011861 |
| Molecular Formula | C20H16N4OS |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | N-[3-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(Nc2ncnc3scc(-c4ccccc4)c23)c1 |
| InChI | InChI=1S/C20H16N4OS/c1-13(25)23-15-8-5-9-16(10-15)24-19-18-17(14-6-3-2-4-7-14)11-26-20(18)22-12-21-19/h2-12H,1H3,(H,23,25)(H,21,22,24) |
| InChIKey | XEXFEZXPXDYTJX-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[3-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenyl]acetamide?
The IUPAC name of N-[3-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenyl]acetamide (CID 21011861) is N-[3-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenyl]acetamide.
What is the SMILES notation for N-[3-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenyl]acetamide?
The canonical SMILES for N-[3-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenyl]acetamide is CC(=O)Nc1cccc(Nc2ncnc3scc(-c4ccccc4)c23)c1.
What is the InChIKey of N-[3-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenyl]acetamide?
The InChIKey is XEXFEZXPXDYTJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16N4OS/c1-13(25)23-15-8-5-9-16(10-15)24-19-18-17(14-6-3-2-4-7-14)11-26-20(18)22-12-21-19/h2-12H,1H3,(H,23,25)(H,21,22,24).
What are the key properties of N-[3-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenyl]acetamide?
N-[3-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenyl]acetamide has a molecular weight of 360.44 g/mol, XLogP of 5.06, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenyl]acetamide is sourced from PubChem (CID 21011861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).