About 2,3,4,5-tetrachlorophenol
2,3,4,5-tetrachlorophenol (PubChem CID 21013) has the molecular formula C6H2Cl4O
and a molecular weight of 231.89 g/mol. Its IUPAC name is 2,3,4,5-tetrachlorophenol.
Molecular Properties
| Compound Name | 2,3,4,5-tetrachlorophenol |
| PubChem CID | 21013 |
| Molecular Formula | C6H2Cl4O |
| Molecular Weight | 231.89 g/mol |
| Exact Mass | 229.89 |
| IUPAC Name | 2,3,4,5-tetrachlorophenol |
| SMILES | Oc1cc(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C6H2Cl4O/c7-2-1-3(11)5(9)6(10)4(2)8/h1,11H |
| InChIKey | RULKYXXCCZZKDZ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.89 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 2,3,4,5-tetrachlorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,4,5-tetrachlorophenol?
The IUPAC name of 2,3,4,5-tetrachlorophenol (CID 21013) is 2,3,4,5-tetrachlorophenol.
What is the SMILES notation for 2,3,4,5-tetrachlorophenol?
The canonical SMILES for 2,3,4,5-tetrachlorophenol is Oc1cc(Cl)c(Cl)c(Cl)c1Cl.
What is the InChIKey of 2,3,4,5-tetrachlorophenol?
The InChIKey is RULKYXXCCZZKDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2Cl4O/c7-2-1-3(11)5(9)6(10)4(2)8/h1,11H.
What are the key properties of 2,3,4,5-tetrachlorophenol?
2,3,4,5-tetrachlorophenol has a molecular weight of 231.89 g/mol, XLogP of 4.01, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4,5-tetrachlorophenol is sourced from PubChem (CID 21013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).