C18H22F2N2O — CID 21014058
(Z,1S,4R)-N-[(Z)-[2-(difluoromethoxy)phenyl]methylideneamino]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine (PubChem CID 21014058) has the molecular formula C18H22F2N2O and a molecular weight of 320.38 g/mol. Its IUPAC name is (Z,1S,4R)-N-[(Z)-[2-(difluoromethoxy)phenyl]methylideneamino]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine.
| Compound Name | (Z,1S,4R)-N-[(Z)-[2-(difluoromethoxy)phenyl]methylideneamino]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine |
|---|---|
| PubChem CID | 21014058 |
| Molecular Formula | C18H22F2N2O |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | (Z,1S,4R)-N-[(Z)-[2-(difluoromethoxy)phenyl]methylideneamino]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine |
| SMILES | CC1(C)[C@@H]2CC[C@]1(C)/C(=N/N=C\c1ccccc1OC(F)F)C2 |
| InChI | InChI=1S/C18H22F2N2O/c1-17(2)13-8-9-18(17,3)15(10-13)22-21-11-12-6-4-5-7-14(12)23-16(19)20/h4-7,11,13,16H,8-10H2,1-3H3/b21-11-,22-15+/t13-,18-/m1/s1 |
| InChIKey | XDTXJGAJPNWKII-URQCCRFQSA-N |
| XLogP | 4.91 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|