C20H30O2S3 — CID 21014811
S-[2-(2-methylsulfanylethylsulfanyl)ethyl] 9-acetyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carbothioate (PubChem CID 21014811) has the molecular formula C20H30O2S3 and a molecular weight of 398.66 g/mol. Its IUPAC name is S-[2-(2-methylsulfanylethylsulfanyl)ethyl] 9-acetyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carbothioate.
| Compound Name | S-[2-(2-methylsulfanylethylsulfanyl)ethyl] 9-acetyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carbothioate |
|---|---|
| PubChem CID | 21014811 |
| Molecular Formula | C20H30O2S3 |
| Molecular Weight | 398.66 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | S-[2-(2-methylsulfanylethylsulfanyl)ethyl] 9-acetyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carbothioate |
| SMILES | CSCCSCCSC(=O)C1CC2CC1C1C3CC(C(C)=O)C(C3)C21 |
| InChI | InChI=1S/C20H30O2S3/c1-11(21)14-7-12-8-15(14)18-13-9-16(19(12)18)17(10-13)20(22)25-6-5-24-4-3-23-2/h12-19H,3-10H2,1-2H3 |
| InChIKey | UAQMQZRWLDKGLP-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.66 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|