About 7-chloro-3-imidazol-1-yl-1,2,4-benzotriazine
7-chloro-3-imidazol-1-yl-1,2,4-benzotriazine (PubChem CID 21014966) has the molecular formula C10H6ClN5
and a molecular weight of 231.65 g/mol. Its IUPAC name is 7-chloro-3-imidazol-1-yl-1,2,4-benzotriazine.
Molecular Properties
| Compound Name | 7-chloro-3-imidazol-1-yl-1,2,4-benzotriazine |
| PubChem CID | 21014966 |
| Molecular Formula | C10H6ClN5 |
| Molecular Weight | 231.65 g/mol |
| Exact Mass | 231.03 |
| IUPAC Name | 7-chloro-3-imidazol-1-yl-1,2,4-benzotriazine |
| SMILES | Clc1ccc2nc(-n3ccnc3)nnc2c1 |
| InChI | InChI=1S/C10H6ClN5/c11-7-1-2-8-9(5-7)14-15-10(13-8)16-4-3-12-6-16/h1-6H |
| InChIKey | DGTGEGYFJGFHNA-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.65 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-chloro-3-imidazol-1-yl-1,2,4-benzotriazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-3-imidazol-1-yl-1,2,4-benzotriazine?
The IUPAC name of 7-chloro-3-imidazol-1-yl-1,2,4-benzotriazine (CID 21014966) is 7-chloro-3-imidazol-1-yl-1,2,4-benzotriazine.
What is the SMILES notation for 7-chloro-3-imidazol-1-yl-1,2,4-benzotriazine?
The canonical SMILES for 7-chloro-3-imidazol-1-yl-1,2,4-benzotriazine is Clc1ccc2nc(-n3ccnc3)nnc2c1.
What is the InChIKey of 7-chloro-3-imidazol-1-yl-1,2,4-benzotriazine?
The InChIKey is DGTGEGYFJGFHNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6ClN5/c11-7-1-2-8-9(5-7)14-15-10(13-8)16-4-3-12-6-16/h1-6H.
What are the key properties of 7-chloro-3-imidazol-1-yl-1,2,4-benzotriazine?
7-chloro-3-imidazol-1-yl-1,2,4-benzotriazine has a molecular weight of 231.65 g/mol, XLogP of 1.86, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-3-imidazol-1-yl-1,2,4-benzotriazine is sourced from PubChem (CID 21014966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).