About methyl 2,2,3-trimethyl-1,3-oxazolidine-4-carboxylate
methyl 2,2,3-trimethyl-1,3-oxazolidine-4-carboxylate (PubChem CID 21015126) has the molecular formula C8H15NO3
and a molecular weight of 173.21 g/mol. Its IUPAC name is methyl 2,2,3-trimethyl-1,3-oxazolidine-4-carboxylate.
Molecular Properties
| Compound Name | methyl 2,2,3-trimethyl-1,3-oxazolidine-4-carboxylate |
| PubChem CID | 21015126 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | methyl 2,2,3-trimethyl-1,3-oxazolidine-4-carboxylate |
| SMILES | COC(=O)C1COC(C)(C)N1C |
| InChI | InChI=1S/C8H15NO3/c1-8(2)9(3)6(5-12-8)7(10)11-4/h6H,5H2,1-4H3 |
| InChIKey | ZTQRYLJQFOUWRX-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2,2,3-trimethyl-1,3-oxazolidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2,2,3-trimethyl-1,3-oxazolidine-4-carboxylate?
The IUPAC name of methyl 2,2,3-trimethyl-1,3-oxazolidine-4-carboxylate (CID 21015126) is methyl 2,2,3-trimethyl-1,3-oxazolidine-4-carboxylate.
What is the SMILES notation for methyl 2,2,3-trimethyl-1,3-oxazolidine-4-carboxylate?
The canonical SMILES for methyl 2,2,3-trimethyl-1,3-oxazolidine-4-carboxylate is COC(=O)C1COC(C)(C)N1C.
What is the InChIKey of methyl 2,2,3-trimethyl-1,3-oxazolidine-4-carboxylate?
The InChIKey is ZTQRYLJQFOUWRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO3/c1-8(2)9(3)6(5-12-8)7(10)11-4/h6H,5H2,1-4H3.
What are the key properties of methyl 2,2,3-trimethyl-1,3-oxazolidine-4-carboxylate?
methyl 2,2,3-trimethyl-1,3-oxazolidine-4-carboxylate has a molecular weight of 173.21 g/mol, XLogP of 0.23, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,2,3-trimethyl-1,3-oxazolidine-4-carboxylate is sourced from PubChem (CID 21015126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).