C19H32O4Si — CID 21015790
tert-butyl-[[5-(cyclopenta-1,3-dien-1-ylmethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]-dimethylsilane (PubChem CID 21015790) has the molecular formula C19H32O4Si and a molecular weight of 352.55 g/mol. Its IUPAC name is tert-butyl-[[5-(cyclopenta-1,3-dien-1-ylmethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[5-(cyclopenta-1,3-dien-1-ylmethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 21015790 |
| Molecular Formula | C19H32O4Si |
| Molecular Weight | 352.55 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | tert-butyl-[[5-(cyclopenta-1,3-dien-1-ylmethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]-dimethylsilane |
| SMILES | CC1(C)OC2OC(CC3=CC=CC3)C(O[Si](C)(C)C(C)(C)C)C2O1 |
| InChI | InChI=1S/C19H32O4Si/c1-18(2,3)24(6,7)23-15-14(12-13-10-8-9-11-13)20-17-16(15)21-19(4,5)22-17/h8-10,14-17H,11-12H2,1-7H3 |
| InChIKey | JFLQRSQKYKMDMF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.55 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|