About 2-(azepan-1-yl)-N-(2,3,4-trifluorophenyl)acetamide
2-(azepan-1-yl)-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 2101664) has the molecular formula C14H17F3N2O
and a molecular weight of 286.30 g/mol. Its IUPAC name is 2-(azepan-1-yl)-N-(2,3,4-trifluorophenyl)acetamide.
Molecular Properties
| Compound Name | 2-(azepan-1-yl)-N-(2,3,4-trifluorophenyl)acetamide |
| PubChem CID | 2101664 |
| Molecular Formula | C14H17F3N2O |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 2-(azepan-1-yl)-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | O=C(CN1CCCCCC1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H17F3N2O/c15-10-5-6-11(14(17)13(10)16)18-12(20)9-19-7-3-1-2-4-8-19/h5-6H,1-4,7-9H2,(H,18,20) |
| InChIKey | WNROZSOABXSQKV-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(azepan-1-yl)-N-(2,3,4-trifluorophenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(azepan-1-yl)-N-(2,3,4-trifluorophenyl)acetamide?
The IUPAC name of 2-(azepan-1-yl)-N-(2,3,4-trifluorophenyl)acetamide (CID 2101664) is 2-(azepan-1-yl)-N-(2,3,4-trifluorophenyl)acetamide.
What is the SMILES notation for 2-(azepan-1-yl)-N-(2,3,4-trifluorophenyl)acetamide?
The canonical SMILES for 2-(azepan-1-yl)-N-(2,3,4-trifluorophenyl)acetamide is O=C(CN1CCCCCC1)Nc1ccc(F)c(F)c1F.
What is the InChIKey of 2-(azepan-1-yl)-N-(2,3,4-trifluorophenyl)acetamide?
The InChIKey is WNROZSOABXSQKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17F3N2O/c15-10-5-6-11(14(17)13(10)16)18-12(20)9-19-7-3-1-2-4-8-19/h5-6H,1-4,7-9H2,(H,18,20).
What are the key properties of 2-(azepan-1-yl)-N-(2,3,4-trifluorophenyl)acetamide?
2-(azepan-1-yl)-N-(2,3,4-trifluorophenyl)acetamide has a molecular weight of 286.30 g/mol, XLogP of 2.92, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(azepan-1-yl)-N-(2,3,4-trifluorophenyl)acetamide is sourced from PubChem (CID 2101664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).