C25H26ClN3O2 — CID 2101756
N-(2-benzoyl-4-chlorophenyl)-2-[[(2S)-2-(dimethylamino)-2-phenylethyl]amino]acetamide (PubChem CID 2101756) has the molecular formula C25H26ClN3O2 and a molecular weight of 435.96 g/mol. Its IUPAC name is N-(2-benzoyl-4-chlorophenyl)-2-[[(2S)-2-(dimethylamino)-2-phenylethyl]amino]acetamide.
| Compound Name | N-(2-benzoyl-4-chlorophenyl)-2-[[(2S)-2-(dimethylamino)-2-phenylethyl]amino]acetamide |
|---|---|
| PubChem CID | 2101756 |
| Molecular Formula | C25H26ClN3O2 |
| Molecular Weight | 435.96 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | N-(2-benzoyl-4-chlorophenyl)-2-[[(2S)-2-(dimethylamino)-2-phenylethyl]amino]acetamide |
| SMILES | CN(C)[C@H](CNCC(=O)Nc1ccc(Cl)cc1C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H26ClN3O2/c1-29(2)23(18-9-5-3-6-10-18)16-27-17-24(30)28-22-14-13-20(26)15-21(22)25(31)19-11-7-4-8-12-19/h3-15,23,27H,16-17H2,1-2H3,(H,28,30)/t23-/m1/s1 |
| InChIKey | GSQZRPDEKIOTCR-HSZRJFAPSA-N |
| XLogP | 4.40 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.96 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |