C34H43NO2 — CID 21017813
[3-[(3R,4S)-1-hexyl-3,4-dimethylpiperidin-4-yl]phenyl] 2,2-diphenylpropanoate (PubChem CID 21017813) has the molecular formula C34H43NO2 and a molecular weight of 497.72 g/mol. Its IUPAC name is [3-[(3R,4S)-1-hexyl-3,4-dimethylpiperidin-4-yl]phenyl] 2,2-diphenylpropanoate.
| Compound Name | [3-[(3R,4S)-1-hexyl-3,4-dimethylpiperidin-4-yl]phenyl] 2,2-diphenylpropanoate |
|---|---|
| PubChem CID | 21017813 |
| Molecular Formula | C34H43NO2 |
| Molecular Weight | 497.72 g/mol |
| Exact Mass | 497.33 |
| IUPAC Name | [3-[(3R,4S)-1-hexyl-3,4-dimethylpiperidin-4-yl]phenyl] 2,2-diphenylpropanoate |
| SMILES | CCCCCCN1CC[C@](C)(c2cccc(OC(=O)C(C)(c3ccccc3)c3ccccc3)c2)[C@@H](C)C1 |
| InChI | InChI=1S/C34H43NO2/c1-5-6-7-14-23-35-24-22-33(3,27(2)26-35)30-20-15-21-31(25-30)37-32(36)34(4,28-16-10-8-11-17-28)29-18-12-9-13-19-29/h8-13,15-21,25,27H,5-7,14,22-24,26H2,1-4H3/t27-,33-/m0/s1 |
| InChIKey | DZTVNODWKRUVNI-CMVGPNDKSA-N |
| XLogP | 7.78 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.72 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|