C10H9F5O2 — CID 21018004
1,1,1,3,3-pentafluoro-3-(2-hydroxy-2-bicyclo[2.2.1]hept-5-enyl)propan-2-one (PubChem CID 21018004) has the molecular formula C10H9F5O2 and a molecular weight of 256.17 g/mol. Its IUPAC name is 1,1,1,3,3-pentafluoro-3-(2-hydroxy-2-bicyclo[2.2.1]hept-5-enyl)propan-2-one.
| Compound Name | 1,1,1,3,3-pentafluoro-3-(2-hydroxy-2-bicyclo[2.2.1]hept-5-enyl)propan-2-one |
|---|---|
| PubChem CID | 21018004 |
| Molecular Formula | C10H9F5O2 |
| Molecular Weight | 256.17 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 1,1,1,3,3-pentafluoro-3-(2-hydroxy-2-bicyclo[2.2.1]hept-5-enyl)propan-2-one |
| SMILES | O=C(C(F)(F)F)C(F)(F)C1(O)CC2C=CC1C2 |
| InChI | InChI=1S/C10H9F5O2/c11-9(12,7(16)10(13,14)15)8(17)4-5-1-2-6(8)3-5/h1-2,5-6,17H,3-4H2 |
| InChIKey | ZTCXSNUQGNUPOS-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.17 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|