C17H23F5O2 — CID 21018007
1-[1-(2-bicyclo[2.2.1]hept-5-enyl)cyclohexyl]-2,2,4,4,4-pentafluorobutane-1,3-diol (PubChem CID 21018007) has the molecular formula C17H23F5O2 and a molecular weight of 354.36 g/mol. Its IUPAC name is 1-[1-(2-bicyclo[2.2.1]hept-5-enyl)cyclohexyl]-2,2,4,4,4-pentafluorobutane-1,3-diol.
| Compound Name | 1-[1-(2-bicyclo[2.2.1]hept-5-enyl)cyclohexyl]-2,2,4,4,4-pentafluorobutane-1,3-diol |
|---|---|
| PubChem CID | 21018007 |
| Molecular Formula | C17H23F5O2 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 1-[1-(2-bicyclo[2.2.1]hept-5-enyl)cyclohexyl]-2,2,4,4,4-pentafluorobutane-1,3-diol |
| SMILES | OC(C(F)(F)F)C(F)(F)C(O)C1(C2CC3C=CC2C3)CCCCC1 |
| InChI | InChI=1S/C17H23F5O2/c18-16(19,14(24)17(20,21)22)13(23)15(6-2-1-3-7-15)12-9-10-4-5-11(12)8-10/h4-5,10-14,23-24H,1-3,6-9H2 |
| InChIKey | VJQYYEOXLMEOOK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|