C10H11F5O3 — CID 21018012
2,2,4,4,4-pentafluoro-1-(7-oxabicyclo[2.2.1]hept-5-en-2-yl)butane-1,3-diol (PubChem CID 21018012) has the molecular formula C10H11F5O3 and a molecular weight of 274.19 g/mol. Its IUPAC name is 2,2,4,4,4-pentafluoro-1-(7-oxabicyclo[2.2.1]hept-5-en-2-yl)butane-1,3-diol.
| Compound Name | 2,2,4,4,4-pentafluoro-1-(7-oxabicyclo[2.2.1]hept-5-en-2-yl)butane-1,3-diol |
|---|---|
| PubChem CID | 21018012 |
| Molecular Formula | C10H11F5O3 |
| Molecular Weight | 274.19 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 2,2,4,4,4-pentafluoro-1-(7-oxabicyclo[2.2.1]hept-5-en-2-yl)butane-1,3-diol |
| SMILES | OC(C1CC2C=CC1O2)C(F)(F)C(O)C(F)(F)F |
| InChI | InChI=1S/C10H11F5O3/c11-9(12,8(17)10(13,14)15)7(16)5-3-4-1-2-6(5)18-4/h1-2,4-8,16-17H,3H2 |
| InChIKey | WPDANDWGDZMPDJ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.19 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|