C14H19F5O2 — CID 21018014
2-(2-bicyclo[2.2.1]hept-5-enyl)-3,3-difluoro-4-(trifluoromethyl)hexane-2,4-diol (PubChem CID 21018014) has the molecular formula C14H19F5O2 and a molecular weight of 314.29 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]hept-5-enyl)-3,3-difluoro-4-(trifluoromethyl)hexane-2,4-diol.
| Compound Name | 2-(2-bicyclo[2.2.1]hept-5-enyl)-3,3-difluoro-4-(trifluoromethyl)hexane-2,4-diol |
|---|---|
| PubChem CID | 21018014 |
| Molecular Formula | C14H19F5O2 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]hept-5-enyl)-3,3-difluoro-4-(trifluoromethyl)hexane-2,4-diol |
| SMILES | CCC(O)(C(F)(F)F)C(F)(F)C(C)(O)C1CC2C=CC1C2 |
| InChI | InChI=1S/C14H19F5O2/c1-3-12(21,14(17,18)19)13(15,16)11(2,20)10-7-8-4-5-9(10)6-8/h4-5,8-10,20-21H,3,6-7H2,1-2H3 |
| InChIKey | NIICKBPAIVWUBS-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|