C13H17F5O3 — CID 21018021
4-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,1,3,3-pentafluoro-2-methoxypentane-2,4-diol (PubChem CID 21018021) has the molecular formula C13H17F5O3 and a molecular weight of 316.27 g/mol. Its IUPAC name is 4-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,1,3,3-pentafluoro-2-methoxypentane-2,4-diol.
| Compound Name | 4-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,1,3,3-pentafluoro-2-methoxypentane-2,4-diol |
|---|---|
| PubChem CID | 21018021 |
| Molecular Formula | C13H17F5O3 |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 4-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,1,3,3-pentafluoro-2-methoxypentane-2,4-diol |
| SMILES | COC(O)(C(F)(F)F)C(F)(F)C(C)(O)C1CC2C=CC1C2 |
| InChI | InChI=1S/C13H17F5O3/c1-10(19,9-6-7-3-4-8(9)5-7)11(14,15)12(20,21-2)13(16,17)18/h3-4,7-9,19-20H,5-6H2,1-2H3 |
| InChIKey | YSCOEVCYQJDFRJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|