C14H19F5O2 — CID 21018026
4-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,1,3,3-pentafluoro-5-methylhexane-2,4-diol (PubChem CID 21018026) has the molecular formula C14H19F5O2 and a molecular weight of 314.29 g/mol. Its IUPAC name is 4-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,1,3,3-pentafluoro-5-methylhexane-2,4-diol.
| Compound Name | 4-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,1,3,3-pentafluoro-5-methylhexane-2,4-diol |
|---|---|
| PubChem CID | 21018026 |
| Molecular Formula | C14H19F5O2 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 4-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,1,3,3-pentafluoro-5-methylhexane-2,4-diol |
| SMILES | CC(C)C(O)(C1CC2C=CC1C2)C(F)(F)C(O)C(F)(F)F |
| InChI | InChI=1S/C14H19F5O2/c1-7(2)12(21,10-6-8-3-4-9(10)5-8)13(15,16)11(20)14(17,18)19/h3-4,7-11,20-21H,5-6H2,1-2H3 |
| InChIKey | CZMIDUVNUCWMOJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|