C12H15F5O2 — CID 21018033
5-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,1,3,3-pentafluoropentane-2,4-diol (PubChem CID 21018033) has the molecular formula C12H15F5O2 and a molecular weight of 286.24 g/mol. Its IUPAC name is 5-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,1,3,3-pentafluoropentane-2,4-diol.
| Compound Name | 5-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,1,3,3-pentafluoropentane-2,4-diol |
|---|---|
| PubChem CID | 21018033 |
| Molecular Formula | C12H15F5O2 |
| Molecular Weight | 286.24 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 5-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,1,3,3-pentafluoropentane-2,4-diol |
| SMILES | OC(CC1CC2C=CC1C2)C(F)(F)C(O)C(F)(F)F |
| InChI | InChI=1S/C12H15F5O2/c13-11(14,10(19)12(15,16)17)9(18)5-8-4-6-1-2-7(8)3-6/h1-2,6-10,18-19H,3-5H2 |
| InChIKey | YADZGFVMLLQBOD-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.24 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|