C13H17F5O2 — CID 21018034
5-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,1,3,3-pentafluoro-2-methylpentane-2,4-diol (PubChem CID 21018034) has the molecular formula C13H17F5O2 and a molecular weight of 300.27 g/mol. Its IUPAC name is 5-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,1,3,3-pentafluoro-2-methylpentane-2,4-diol.
| Compound Name | 5-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,1,3,3-pentafluoro-2-methylpentane-2,4-diol |
|---|---|
| PubChem CID | 21018034 |
| Molecular Formula | C13H17F5O2 |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 5-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,1,3,3-pentafluoro-2-methylpentane-2,4-diol |
| SMILES | CC(O)(C(F)(F)F)C(F)(F)C(O)CC1CC2C=CC1C2 |
| InChI | InChI=1S/C13H17F5O2/c1-11(20,13(16,17)18)12(14,15)10(19)6-9-5-7-2-3-8(9)4-7/h2-3,7-10,19-20H,4-6H2,1H3 |
| InChIKey | RLRCZKXOFPQWJT-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|