C16H17F5O2 — CID 21018044
1,1,1,3,3-pentafluoro-4-hydroxy-4-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)butan-2-one (PubChem CID 21018044) has the molecular formula C16H17F5O2 and a molecular weight of 336.30 g/mol. Its IUPAC name is 1,1,1,3,3-pentafluoro-4-hydroxy-4-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)butan-2-one.
| Compound Name | 1,1,1,3,3-pentafluoro-4-hydroxy-4-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)butan-2-one |
|---|---|
| PubChem CID | 21018044 |
| Molecular Formula | C16H17F5O2 |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 1,1,1,3,3-pentafluoro-4-hydroxy-4-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)butan-2-one |
| SMILES | O=C(C(F)(F)F)C(F)(F)C(O)C1CC2CC1C1C3C=CC(C3)C21 |
| InChI | InChI=1S/C16H17F5O2/c17-15(18,14(23)16(19,20)21)13(22)10-5-8-4-9(10)12-7-2-1-6(3-7)11(8)12/h1-2,6-13,22H,3-5H2 |
| InChIKey | KIJJOJGMUKUKBG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|