C18H38N2O — CID 21018113
2-tert-butyl-N-[3-(diethylamino)propyl]-4,4-dimethylpentanamide (PubChem CID 21018113) has the molecular formula C18H38N2O and a molecular weight of 298.51 g/mol. Its IUPAC name is 2-tert-butyl-N-[3-(diethylamino)propyl]-4,4-dimethylpentanamide.
| Compound Name | 2-tert-butyl-N-[3-(diethylamino)propyl]-4,4-dimethylpentanamide |
|---|---|
| PubChem CID | 21018113 |
| Molecular Formula | C18H38N2O |
| Molecular Weight | 298.51 g/mol |
| Exact Mass | 298.30 |
| IUPAC Name | 2-tert-butyl-N-[3-(diethylamino)propyl]-4,4-dimethylpentanamide |
| SMILES | CCN(CC)CCCNC(=O)C(CC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C18H38N2O/c1-9-20(10-2)13-11-12-19-16(21)15(18(6,7)8)14-17(3,4)5/h15H,9-14H2,1-8H3,(H,19,21) |
| InChIKey | BJGZCSSHMFJCKJ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.51 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|