C32H30F2N4 — CID 21018127
2-[4-[bis[4-(4-fluorophenyl)piperidin-1-yl]methylidene]cyclohexa-2,5-dien-1-ylidene]-2-isocyanoacetonitrile (PubChem CID 21018127) has the molecular formula C32H30F2N4 and a molecular weight of 508.62 g/mol. Its IUPAC name is 2-[4-[bis[4-(4-fluorophenyl)piperidin-1-yl]methylidene]cyclohexa-2,5-dien-1-ylidene]-2-isocyanoacetonitrile.
| Compound Name | 2-[4-[bis[4-(4-fluorophenyl)piperidin-1-yl]methylidene]cyclohexa-2,5-dien-1-ylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 21018127 |
| Molecular Formula | C32H30F2N4 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | 2-[4-[bis[4-(4-fluorophenyl)piperidin-1-yl]methylidene]cyclohexa-2,5-dien-1-ylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]C(C#N)=c1ccc(=C(N2CCC(c3ccc(F)cc3)CC2)N2CCC(c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C32H30F2N4/c1-36-31(22-35)27-2-4-28(5-3-27)32(37-18-14-25(15-19-37)23-6-10-29(33)11-7-23)38-20-16-26(17-21-38)24-8-12-30(34)13-9-24/h2-13,25-26H,14-21H2 |
| InChIKey | UHQFAXMPDWUHDS-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 34.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|