C9H10ClF3N2O — CID 21018272
3-amino-2-(2-amino-5-chlorophenyl)-1,1,1-trifluoropropan-2-ol (PubChem CID 21018272) has the molecular formula C9H10ClF3N2O and a molecular weight of 254.64 g/mol. Its IUPAC name is 3-amino-2-(2-amino-5-chlorophenyl)-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-amino-2-(2-amino-5-chlorophenyl)-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 21018272 |
| Molecular Formula | C9H10ClF3N2O |
| Molecular Weight | 254.64 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 3-amino-2-(2-amino-5-chlorophenyl)-1,1,1-trifluoropropan-2-ol |
| SMILES | NCC(O)(c1cc(Cl)ccc1N)C(F)(F)F |
| InChI | InChI=1S/C9H10ClF3N2O/c10-5-1-2-7(15)6(3-5)8(16,4-14)9(11,12)13/h1-3,16H,4,14-15H2 |
| InChIKey | UCBZUCHDRYAZRH-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.64 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|