C10H10F3N3O — CID 21018273
3-azido-1,1,1-trifluoro-2-(2-methylphenyl)propan-2-ol (PubChem CID 21018273) has the molecular formula C10H10F3N3O and a molecular weight of 245.20 g/mol. Its IUPAC name is 3-azido-1,1,1-trifluoro-2-(2-methylphenyl)propan-2-ol.
| Compound Name | 3-azido-1,1,1-trifluoro-2-(2-methylphenyl)propan-2-ol |
|---|---|
| PubChem CID | 21018273 |
| Molecular Formula | C10H10F3N3O |
| Molecular Weight | 245.20 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 3-azido-1,1,1-trifluoro-2-(2-methylphenyl)propan-2-ol |
| SMILES | Cc1ccccc1C(O)(CN=[N+]=[N-])C(F)(F)F |
| InChI | InChI=1S/C10H10F3N3O/c1-7-4-2-3-5-8(7)9(17,6-15-16-14)10(11,12)13/h2-5,17H,6H2,1H3 |
| InChIKey | GLPOLGKTELPMHW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 68.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.20 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|