About 2-[2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethylamino]ethanol
2-[2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethylamino]ethanol (PubChem CID 2101842) has the molecular formula C10H13N3O2S2
and a molecular weight of 271.37 g/mol. Its IUPAC name is 2-[2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethylamino]ethanol.
Molecular Properties
| Compound Name | 2-[2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethylamino]ethanol |
| PubChem CID | 2101842 |
| Molecular Formula | C10H13N3O2S2 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 2-[2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethylamino]ethanol |
| SMILES | OCCNCCSc1nnc(-c2cccs2)o1 |
| InChI | InChI=1S/C10H13N3O2S2/c14-5-3-11-4-7-17-10-13-12-9(15-10)8-2-1-6-16-8/h1-2,6,11,14H,3-5,7H2 |
| InChIKey | BTIKQTBBPJPOGW-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethylamino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethylamino]ethanol?
The IUPAC name of 2-[2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethylamino]ethanol (CID 2101842) is 2-[2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethylamino]ethanol.
What is the SMILES notation for 2-[2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethylamino]ethanol?
The canonical SMILES for 2-[2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethylamino]ethanol is OCCNCCSc1nnc(-c2cccs2)o1.
What is the InChIKey of 2-[2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethylamino]ethanol?
The InChIKey is BTIKQTBBPJPOGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O2S2/c14-5-3-11-4-7-17-10-13-12-9(15-10)8-2-1-6-16-8/h1-2,6,11,14H,3-5,7H2.
What are the key properties of 2-[2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethylamino]ethanol?
2-[2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethylamino]ethanol has a molecular weight of 271.37 g/mol, XLogP of 1.47, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethylamino]ethanol is sourced from PubChem (CID 2101842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).