C12H23BN2O3 — CID 21018654
[4-[(4,4-dimethyl-2-oxo-1,3-oxazolidin-3-yl)methyl]piperidin-1-yl]-methylborinic acid (PubChem CID 21018654) has the molecular formula C12H23BN2O3 and a molecular weight of 254.14 g/mol. Its IUPAC name is [4-[(4,4-dimethyl-2-oxo-1,3-oxazolidin-3-yl)methyl]piperidin-1-yl]-methylborinic acid.
| Compound Name | [4-[(4,4-dimethyl-2-oxo-1,3-oxazolidin-3-yl)methyl]piperidin-1-yl]-methylborinic acid |
|---|---|
| PubChem CID | 21018654 |
| Molecular Formula | C12H23BN2O3 |
| Molecular Weight | 254.14 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | [4-[(4,4-dimethyl-2-oxo-1,3-oxazolidin-3-yl)methyl]piperidin-1-yl]-methylborinic acid |
| SMILES | CB(O)N1CCC(CN2C(=O)OCC2(C)C)CC1 |
| InChI | InChI=1S/C12H23BN2O3/c1-12(2)9-18-11(16)15(12)8-10-4-6-14(7-5-10)13(3)17/h10,17H,4-9H2,1-3H3 |
| InChIKey | VICJREIDEDFACB-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.14 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|