C40H36O17 — CID 21018988
[5,7-diacetyloxy-2-(3,4-diacetyloxyphenyl)-8-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-4-yl]-3,4-dihydro-2H-chromen-3-yl] acetate (PubChem CID 21018988) has the molecular formula C40H36O17 and a molecular weight of 788.71 g/mol. Its IUPAC name is [5,7-diacetyloxy-2-(3,4-diacetyloxyphenyl)-8-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-4-yl]-3,4-dihydro-2H-chromen-3-yl] acetate.
| Compound Name | [5,7-diacetyloxy-2-(3,4-diacetyloxyphenyl)-8-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-4-yl]-3,4-dihydro-2H-chromen-3-yl] acetate |
|---|---|
| PubChem CID | 21018988 |
| Molecular Formula | C40H36O17 |
| Molecular Weight | 788.71 g/mol |
| Exact Mass | 788.20 |
| IUPAC Name | [5,7-diacetyloxy-2-(3,4-diacetyloxyphenyl)-8-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-4-yl]-3,4-dihydro-2H-chromen-3-yl] acetate |
| SMILES | CC(=O)Oc1ccc(C2Oc3c(c(OC(C)=O)cc(OC(C)=O)c3C3c4c(O)cc(O)cc4OC(c4ccc(O)c(O)c4)C3O)CC2OC(C)=O)cc1OC(C)=O |
| InChI | InChI=1S/C40H36O17/c1-16(41)51-28-9-7-22(11-30(28)53-18(3)43)38-33(55-20(5)45)14-24-29(52-17(2)42)15-32(54-19(4)44)35(40(24)57-38)36-34-27(49)12-23(46)13-31(34)56-39(37(36)50)21-6-8-25(47)26(48)10-21/h6-13,15,33,36-39,46-50H,14H2,1-5H3 |
| InChIKey | BTWVSMUQHSJNCI-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 251.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.71 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|