C15H12N2O2 — CID 21019291
9H-fluorene-1,8-dicarboxamide (PubChem CID 21019291) has the molecular formula C15H12N2O2 and a molecular weight of 252.27 g/mol. Its IUPAC name is 9H-fluorene-1,8-dicarboxamide.
| Compound Name | 9H-fluorene-1,8-dicarboxamide |
|---|---|
| PubChem CID | 21019291 |
| Molecular Formula | C15H12N2O2 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 9H-fluorene-1,8-dicarboxamide |
| SMILES | NC(=O)c1cccc2c1Cc1c(C(N)=O)cccc1-2 |
| InChI | InChI=1S/C15H12N2O2/c16-14(18)10-5-1-3-8-9-4-2-6-11(15(17)19)13(9)7-12(8)10/h1-6H,7H2,(H2,16,18)(H2,17,19) |
| InChIKey | XJSFJQINLJAUOE-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |