About 1-(methoxymethyl)-2,3,4-trimethylcyclopentane
1-(methoxymethyl)-2,3,4-trimethylcyclopentane (PubChem CID 21019492) has the molecular formula C10H20O
and a molecular weight of 156.27 g/mol. Its IUPAC name is 1-(methoxymethyl)-2,3,4-trimethylcyclopentane.
Molecular Properties
| Compound Name | 1-(methoxymethyl)-2,3,4-trimethylcyclopentane |
| PubChem CID | 21019492 |
| Molecular Formula | C10H20O |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.15 |
| IUPAC Name | 1-(methoxymethyl)-2,3,4-trimethylcyclopentane |
| SMILES | COCC1CC(C)C(C)C1C |
| InChI | InChI=1S/C10H20O/c1-7-5-10(6-11-4)9(3)8(7)2/h7-10H,5-6H2,1-4H3 |
| InChIKey | ALVDETHFEJEUPN-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(methoxymethyl)-2,3,4-trimethylcyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(methoxymethyl)-2,3,4-trimethylcyclopentane?
The IUPAC name of 1-(methoxymethyl)-2,3,4-trimethylcyclopentane (CID 21019492) is 1-(methoxymethyl)-2,3,4-trimethylcyclopentane.
What is the SMILES notation for 1-(methoxymethyl)-2,3,4-trimethylcyclopentane?
The canonical SMILES for 1-(methoxymethyl)-2,3,4-trimethylcyclopentane is COCC1CC(C)C(C)C1C.
What is the InChIKey of 1-(methoxymethyl)-2,3,4-trimethylcyclopentane?
The InChIKey is ALVDETHFEJEUPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O/c1-7-5-10(6-11-4)9(3)8(7)2/h7-10H,5-6H2,1-4H3.
What are the key properties of 1-(methoxymethyl)-2,3,4-trimethylcyclopentane?
1-(methoxymethyl)-2,3,4-trimethylcyclopentane has a molecular weight of 156.27 g/mol, XLogP of 2.56, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(methoxymethyl)-2,3,4-trimethylcyclopentane is sourced from PubChem (CID 21019492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).