C12H25NO3 — CID 21020056
4-(ethoxymethoxy)-1-hydroxy-2,2,6,6-tetramethylpiperidine (PubChem CID 21020056) has the molecular formula C12H25NO3 and a molecular weight of 231.34 g/mol. Its IUPAC name is 4-(ethoxymethoxy)-1-hydroxy-2,2,6,6-tetramethylpiperidine.
| Compound Name | 4-(ethoxymethoxy)-1-hydroxy-2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 21020056 |
| Molecular Formula | C12H25NO3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.18 |
| IUPAC Name | 4-(ethoxymethoxy)-1-hydroxy-2,2,6,6-tetramethylpiperidine |
| SMILES | CCOCOC1CC(C)(C)N(O)C(C)(C)C1 |
| InChI | InChI=1S/C12H25NO3/c1-6-15-9-16-10-7-11(2,3)13(14)12(4,5)8-10/h10,14H,6-9H2,1-5H3 |
| InChIKey | BWLRGOVCKZZTHA-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|