About CID 21020100
CID 21020100 (PubChem CID 21020100) has the molecular formula C20H31BNO8PS
and a molecular weight of 487.32 g/mol.
Molecular Properties
| Compound Name | CID 21020100 |
| PubChem CID | 21020100 |
| Molecular Formula | C20H31BNO8PS |
| Molecular Weight | 487.32 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | — |
| SMILES | [B]C1CC(OP(=O)(OCC2OC(C)CC2OC(=O)CCC(C)=O)SCC[N+]#[C-])C(CC)O1 |
| InChI | InChI=1S/C20H31BNO8PS/c1-5-15-17(11-19(21)28-15)30-31(25,32-9-8-22-4)26-12-18-16(10-14(3)27-18)29-20(24)7-6-13(2)23/h14-19H,5-12H2,1-3H3 |
| InChIKey | ZXFUGKFNAGGHFW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 101.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 487.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 21020100 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 21020100?
The IUPAC name of CID 21020100 (CID 21020100) is not available.
What is the SMILES notation for CID 21020100?
The canonical SMILES for CID 21020100 is [B]C1CC(OP(=O)(OCC2OC(C)CC2OC(=O)CCC(C)=O)SCC[N+]#[C-])C(CC)O1.
What is the InChIKey of CID 21020100?
The InChIKey is ZXFUGKFNAGGHFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H31BNO8PS/c1-5-15-17(11-19(21)28-15)30-31(25,32-9-8-22-4)26-12-18-16(10-14(3)27-18)29-20(24)7-6-13(2)23/h14-19H,5-12H2,1-3H3.
What are the key properties of CID 21020100?
CID 21020100 has a molecular weight of 487.32 g/mol, XLogP of 3.30, 13 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for CID 21020100 is sourced from PubChem (CID 21020100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).