C62H60O13 — CID 21020160
[4,5-dibenzoyloxy-6-methyl-3-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl benzoate (PubChem CID 21020160) has the molecular formula C62H60O13 and a molecular weight of 1013.15 g/mol. Its IUPAC name is [4,5-dibenzoyloxy-6-methyl-3-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl benzoate.
| Compound Name | [4,5-dibenzoyloxy-6-methyl-3-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 21020160 |
| Molecular Formula | C62H60O13 |
| Molecular Weight | 1013.15 g/mol |
| Exact Mass | 1012.40 |
| IUPAC Name | [4,5-dibenzoyloxy-6-methyl-3-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl benzoate |
| SMILES | CC1OC(COC(=O)c2ccccc2)C(OC2OC(COCc3ccccc3)C(OCc3ccccc3)C(OCc3ccccc3)C2OCc2ccccc2)C(OC(=O)c2ccccc2)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C62H60O13/c1-43-53(73-60(64)49-33-19-7-20-34-49)57(74-61(65)50-35-21-8-22-36-50)55(52(71-43)42-70-59(63)48-31-17-6-18-32-48)75-62-58(69-40-47-29-15-5-16-30-47)56(68-39-46-27-13-4-14-28-46)54(67-38-45-25-11-3-12-26-45)51(72-62)41-66-37-44-23-9-2-10-24-44/h2-36,43,51-58,62H,37-42H2,1H3 |
| InChIKey | NJOIXZMXSKUWAX-UHFFFAOYSA-N |
| XLogP | 10.16 |
| TPSA | 143.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 75 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1013.15 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|