C24H40N2O2 — CID 21020517
1,4,5,6-tetramethyl-2-N,2-N,3-N,3-N-tetrapropylbicyclo[2.2.0]hexa-2,5-diene-2,3-dicarboxamide (PubChem CID 21020517) has the molecular formula C24H40N2O2 and a molecular weight of 388.60 g/mol. Its IUPAC name is 1,4,5,6-tetramethyl-2-N,2-N,3-N,3-N-tetrapropylbicyclo[2.2.0]hexa-2,5-diene-2,3-dicarboxamide.
| Compound Name | 1,4,5,6-tetramethyl-2-N,2-N,3-N,3-N-tetrapropylbicyclo[2.2.0]hexa-2,5-diene-2,3-dicarboxamide |
|---|---|
| PubChem CID | 21020517 |
| Molecular Formula | C24H40N2O2 |
| Molecular Weight | 388.60 g/mol |
| Exact Mass | 388.31 |
| IUPAC Name | 1,4,5,6-tetramethyl-2-N,2-N,3-N,3-N-tetrapropylbicyclo[2.2.0]hexa-2,5-diene-2,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)C1=C(C(=O)N(CCC)CCC)C2(C)C(C)=C(C)C12C |
| InChI | InChI=1S/C24H40N2O2/c1-9-13-25(14-10-2)21(27)19-20(22(28)26(15-11-3)16-12-4)24(8)18(6)17(5)23(19,24)7/h9-16H2,1-8H3 |
| InChIKey | IAKGZWWCHWNQOJ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.60 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|