About 2-(1,2-diphenylethenyl)pyridine;(Z)-4-hydroxypent-3-en-2-one;iridium
2-(1,2-diphenylethenyl)pyridine;(Z)-4-hydroxypent-3-en-2-one;iridium (PubChem CID 21020583) has the molecular formula C24H22IrNO2-
and a molecular weight of 548.66 g/mol. Its IUPAC name is 2-(1,2-diphenylethenyl)pyridine;(Z)-4-hydroxypent-3-en-2-one;iridium.
Molecular Properties
| Compound Name | 2-(1,2-diphenylethenyl)pyridine;(Z)-4-hydroxypent-3-en-2-one;iridium |
| PubChem CID | 21020583 |
| Molecular Formula | C24H22IrNO2- |
| Molecular Weight | 548.66 g/mol |
| Exact Mass | 549.13 |
| IUPAC Name | 2-(1,2-diphenylethenyl)pyridine;(Z)-4-hydroxypent-3-en-2-one;iridium |
| SMILES | CC(=O)/C=C(/C)O.[C-](=C(\c1ccccc1)c1ccccn1)\c1ccccc1.[Ir] |
| InChI | InChI=1S/C19H14N.C5H8O2.Ir/c1-3-9-16(10-4-1)15-18(17-11-5-2-6-12-17)19-13-7-8-14-20-19;1-4(6)3-5(2)7;/h1-14H;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | MPGBTKRBWPAZMC-LWFKIUJUSA-N |
| XLogP | 5.40 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 548.66 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,2-diphenylethenyl)pyridine;(Z)-4-hydroxypent-3-en-2-one;iridium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,2-diphenylethenyl)pyridine;(Z)-4-hydroxypent-3-en-2-one;iridium?
The IUPAC name of 2-(1,2-diphenylethenyl)pyridine;(Z)-4-hydroxypent-3-en-2-one;iridium (CID 21020583) is 2-(1,2-diphenylethenyl)pyridine;(Z)-4-hydroxypent-3-en-2-one;iridium.
What is the SMILES notation for 2-(1,2-diphenylethenyl)pyridine;(Z)-4-hydroxypent-3-en-2-one;iridium?
The canonical SMILES for 2-(1,2-diphenylethenyl)pyridine;(Z)-4-hydroxypent-3-en-2-one;iridium is CC(=O)/C=C(/C)O.[C-](=C(\c1ccccc1)c1ccccn1)\c1ccccc1.[Ir].
What is the InChIKey of 2-(1,2-diphenylethenyl)pyridine;(Z)-4-hydroxypent-3-en-2-one;iridium?
The InChIKey is MPGBTKRBWPAZMC-LWFKIUJUSA-N. The full InChI is InChI=1S/C19H14N.C5H8O2.Ir/c1-3-9-16(10-4-1)15-18(17-11-5-2-6-12-17)19-13-7-8-14-20-19;1-4(6)3-5(2)7;/h1-14H;3,6H,1-2H3;/q-1;;/b;4-3-;.
What are the key properties of 2-(1,2-diphenylethenyl)pyridine;(Z)-4-hydroxypent-3-en-2-one;iridium?
2-(1,2-diphenylethenyl)pyridine;(Z)-4-hydroxypent-3-en-2-one;iridium has a molecular weight of 548.66 g/mol, XLogP of 5.40, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2-diphenylethenyl)pyridine;(Z)-4-hydroxypent-3-en-2-one;iridium is sourced from PubChem (CID 21020583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).