C14H16F9NO — CID 21020669
1-[2-butyl-2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)aziridin-1-yl]-2-methylprop-2-en-1-one (PubChem CID 21020669) has the molecular formula C14H16F9NO and a molecular weight of 385.27 g/mol. Its IUPAC name is 1-[2-butyl-2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)aziridin-1-yl]-2-methylprop-2-en-1-one.
| Compound Name | 1-[2-butyl-2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)aziridin-1-yl]-2-methylprop-2-en-1-one |
|---|---|
| PubChem CID | 21020669 |
| Molecular Formula | C14H16F9NO |
| Molecular Weight | 385.27 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 1-[2-butyl-2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)aziridin-1-yl]-2-methylprop-2-en-1-one |
| SMILES | C=C(C)C(=O)N1CC1(CCCC)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H16F9NO/c1-4-5-6-10(7-24(10)9(25)8(2)3)11(15,16)12(17,18)13(19,20)14(21,22)23/h2,4-7H2,1,3H3 |
| InChIKey | ZMAYKKOQBFTGOQ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 20.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.27 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|