C15H16F13NO — CID 21020716
N,2-dimethyl-N-(5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecyl)prop-2-enamide (PubChem CID 21020716) has the molecular formula C15H16F13NO and a molecular weight of 473.27 g/mol. Its IUPAC name is N,2-dimethyl-N-(5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecyl)prop-2-enamide.
| Compound Name | N,2-dimethyl-N-(5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecyl)prop-2-enamide |
|---|---|
| PubChem CID | 21020716 |
| Molecular Formula | C15H16F13NO |
| Molecular Weight | 473.27 g/mol |
| Exact Mass | 473.10 |
| IUPAC Name | N,2-dimethyl-N-(5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecyl)prop-2-enamide |
| SMILES | C=C(C)C(=O)N(C)CCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H16F13NO/c1-8(2)9(30)29(3)7-5-4-6-10(16,17)11(18,19)12(20,21)13(22,23)14(24,25)15(26,27)28/h1,4-7H2,2-3H3 |
| InChIKey | APCSQIIPSDIYDI-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.27 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|