C16H14F17NO — CID 21020726
N-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyl)-N,2-dimethylprop-2-enamide (PubChem CID 21020726) has the molecular formula C16H14F17NO and a molecular weight of 559.26 g/mol. Its IUPAC name is N-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyl)-N,2-dimethylprop-2-enamide.
| Compound Name | N-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyl)-N,2-dimethylprop-2-enamide |
|---|---|
| PubChem CID | 21020726 |
| Molecular Formula | C16H14F17NO |
| Molecular Weight | 559.26 g/mol |
| Exact Mass | 559.08 |
| IUPAC Name | N-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyl)-N,2-dimethylprop-2-enamide |
| SMILES | C=C(C)C(=O)N(C)CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H14F17NO/c1-7(2)8(35)34(3)6-4-5-9(17,18)10(19,20)11(21,22)12(23,24)13(25,26)14(27,28)15(29,30)16(31,32)33/h1,4-6H2,2-3H3 |
| InChIKey | BSAINDYMGBTIRK-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.26 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|