C18H18F17NO — CID 21020743
N-(7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-heptadecafluorotetradecyl)-2-methylprop-2-enamide (PubChem CID 21020743) has the molecular formula C18H18F17NO and a molecular weight of 587.31 g/mol. Its IUPAC name is N-(7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-heptadecafluorotetradecyl)-2-methylprop-2-enamide.
| Compound Name | N-(7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-heptadecafluorotetradecyl)-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 21020743 |
| Molecular Formula | C18H18F17NO |
| Molecular Weight | 587.31 g/mol |
| Exact Mass | 587.11 |
| IUPAC Name | N-(7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-heptadecafluorotetradecyl)-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NCCCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H18F17NO/c1-9(2)10(37)36-8-6-4-3-5-7-11(19,20)12(21,22)13(23,24)14(25,26)15(27,28)16(29,30)17(31,32)18(33,34)35/h1,3-8H2,2H3,(H,36,37) |
| InChIKey | YZZCGGCTZSFEJQ-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.31 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|